C14H25NOS4 — CID 138393163
1-(1,4,10,13-tetrathia-7-azacyclohexadec-7-yl)prop-2-en-1-one (PubChem CID 138393163) has the molecular formula C14H25NOS4 and a molecular weight of 351.63 g/mol. Its IUPAC name is 1-(1,4,10,13-tetrathia-7-azacyclohexadec-7-yl)prop-2-en-1-one.
| Compound Name | 1-(1,4,10,13-tetrathia-7-azacyclohexadec-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 138393163 |
| Molecular Formula | C14H25NOS4 |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-(1,4,10,13-tetrathia-7-azacyclohexadec-7-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCSCCSCCCSCCSCC1 |
| InChI | InChI=1S/C14H25NOS4/c1-2-14(16)15-4-8-19-12-10-17-6-3-7-18-11-13-20-9-5-15/h2H,1,3-13H2 |
| InChIKey | NHMLHFUFBPXUGA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|