C8H13NOS — CID 61419364
1-(1,4-thiazepan-4-yl)prop-2-en-1-one (PubChem CID 61419364) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 1-(1,4-thiazepan-4-yl)prop-2-en-1-one.
| Compound Name | 1-(1,4-thiazepan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 61419364 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1-(1,4-thiazepan-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C8H13NOS/c1-2-8(10)9-4-3-6-11-7-5-9/h2H,1,3-7H2 |
| InChIKey | NGNXDCGXLCTBKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|