C39H44B2O6 — CID 102408389
ethyl 2-phenyl-3,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate (PubChem CID 102408389) has the molecular formula C39H44B2O6 and a molecular weight of 630.40 g/mol. Its IUPAC name is ethyl 2-phenyl-3,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate.
| Compound Name | ethyl 2-phenyl-3,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 102408389 |
| Molecular Formula | C39H44B2O6 |
| Molecular Weight | 630.40 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | ethyl 2-phenyl-3,6-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1c(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C39H44B2O6/c1-10-43-35(42)34-32(27-18-22-30(23-19-27)41-46-38(6,7)39(8,9)47-41)25-24-31(33(34)28-14-12-11-13-15-28)26-16-20-29(21-17-26)40-44-36(2,3)37(4,5)45-40/h11-25H,10H2,1-9H3 |
| InChIKey | KYCLQFUSFIGROG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.40 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|