About tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane
tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane (PubChem CID 102408982) has the molecular formula C16H19PSe2
and a molecular weight of 400.22 g/mol. Its IUPAC name is tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane |
| PubChem CID | 102408982 |
| Molecular Formula | C16H19PSe2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane |
| SMILES | CC(C)(C)[Se]P(=[Se])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19PSe2/c1-16(2,3)19-17(18,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | LTWXBZSXJDRXNF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane?
The IUPAC name of tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane (CID 102408982) is tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane.
What is the SMILES notation for tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane?
The canonical SMILES for tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane is CC(C)(C)[Se]P(=[Se])(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane?
The InChIKey is LTWXBZSXJDRXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19PSe2/c1-16(2,3)19-17(18,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3.
What are the key properties of tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane?
tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane has a molecular weight of 400.22 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylselanyl-diphenyl-selanylidene-λ5-phosphane is sourced from PubChem (CID 102408982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).