About diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane
diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane (PubChem CID 10984404) has the molecular formula C25H22P2Se2
and a molecular weight of 542.32 g/mol. Its IUPAC name is diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane.
Molecular Properties
| Compound Name | diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane |
| PubChem CID | 10984404 |
| Molecular Formula | C25H22P2Se2 |
| Molecular Weight | 542.32 g/mol |
| Exact Mass | 543.95 |
| IUPAC Name | diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane |
| SMILES | [Se]=P(CP(=[Se])(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22P2Se2/c28-26(22-13-5-1-6-14-22,23-15-7-2-8-16-23)21-27(29,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2 |
| InChIKey | JYDISXLSAOPJKC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane?
The IUPAC name of diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane (CID 10984404) is diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane.
What is the SMILES notation for diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane?
The canonical SMILES for diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane is [Se]=P(CP(=[Se])(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane?
The InChIKey is JYDISXLSAOPJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22P2Se2/c28-26(22-13-5-1-6-14-22,23-15-7-2-8-16-23)21-27(29,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2.
What are the key properties of diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane?
diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane has a molecular weight of 542.32 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphinoselenoylmethyl-diphenyl-selanylidene-lambda5-phosphane is sourced from PubChem (CID 10984404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).