C15H26BN3O2 — CID 102409758
(4R,5R)-2-(azidomethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane (PubChem CID 102409758) has the molecular formula C15H26BN3O2 and a molecular weight of 291.20 g/mol. Its IUPAC name is (4R,5R)-2-(azidomethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-2-(azidomethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102409758 |
| Molecular Formula | C15H26BN3O2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (4R,5R)-2-(azidomethyl)-4,5-dicyclohexyl-1,3,2-dioxaborolane |
| SMILES | [N-]=[N+]=NCB1O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C15H26BN3O2/c17-19-18-11-16-20-14(12-7-3-1-4-8-12)15(21-16)13-9-5-2-6-10-13/h12-15H,1-11H2/t14-,15-/m1/s1 |
| InChIKey | AYALENSBZRZYKS-HUUCEWRRSA-N |
| XLogP | 4.27 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|