C17H17NO5 — CID 102409976
dimethyl (2R,5R)-2-(4-cyanophenyl)-5-ethenyloxolane-3,3-dicarboxylate (PubChem CID 102409976) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is dimethyl (2R,5R)-2-(4-cyanophenyl)-5-ethenyloxolane-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2-(4-cyanophenyl)-5-ethenyloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102409976 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | dimethyl (2R,5R)-2-(4-cyanophenyl)-5-ethenyloxolane-3,3-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](c2ccc(C#N)cc2)O1 |
| InChI | InChI=1S/C17H17NO5/c1-4-13-9-17(15(19)21-2,16(20)22-3)14(23-13)12-7-5-11(10-18)6-8-12/h4-8,13-14H,1,9H2,2-3H3/t13-,14+/m0/s1 |
| InChIKey | GYRINKNBLOELIC-UONOGXRCSA-N |
| XLogP | 1.91 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|