C24H32OSi — CID 102410662
triethyl-[(1Z,4E)-4-methyl-3,5-diphenylpenta-1,4-dienoxy]silane (PubChem CID 102410662) has the molecular formula C24H32OSi and a molecular weight of 364.61 g/mol. Its IUPAC name is triethyl-[(1Z,4E)-4-methyl-3,5-diphenylpenta-1,4-dienoxy]silane.
| Compound Name | triethyl-[(1Z,4E)-4-methyl-3,5-diphenylpenta-1,4-dienoxy]silane |
|---|---|
| PubChem CID | 102410662 |
| Molecular Formula | C24H32OSi |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | triethyl-[(1Z,4E)-4-methyl-3,5-diphenylpenta-1,4-dienoxy]silane |
| SMILES | CC[Si](CC)(CC)O/C=C\C(/C(C)=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32OSi/c1-5-26(6-2,7-3)25-19-18-24(23-16-12-9-13-17-23)21(4)20-22-14-10-8-11-15-22/h8-20,24H,5-7H2,1-4H3/b19-18-,21-20+ |
| InChIKey | ZRKCDMJFCBIFQH-DCOWGZKISA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|