C9H15Cl2NO3 — CID 102410703
(2S,4S)-5,5-dichloro-4-methyl-2-(propanoylamino)pentanoic acid (PubChem CID 102410703) has the molecular formula C9H15Cl2NO3 and a molecular weight of 256.13 g/mol. Its IUPAC name is (2S,4S)-5,5-dichloro-4-methyl-2-(propanoylamino)pentanoic acid.
| Compound Name | (2S,4S)-5,5-dichloro-4-methyl-2-(propanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 102410703 |
| Molecular Formula | C9H15Cl2NO3 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (2S,4S)-5,5-dichloro-4-methyl-2-(propanoylamino)pentanoic acid |
| SMILES | CCC(=O)N[C@@H](C[C@H](C)C(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C9H15Cl2NO3/c1-3-7(13)12-6(9(14)15)4-5(2)8(10)11/h5-6,8H,3-4H2,1-2H3,(H,12,13)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | BYJQXSIXZLRUFH-WDSKDSINSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|