C11H15Cl6NO3 — CID 139114182
(2S,4S)-5,5,5-trichloro-4-methyl-2-[[(3S)-4,4,4-trichloro-3-methylbutanoyl]amino]pentanoic acid (PubChem CID 139114182) has the molecular formula C11H15Cl6NO3 and a molecular weight of 421.96 g/mol. Its IUPAC name is (2S,4S)-5,5,5-trichloro-4-methyl-2-[[(3S)-4,4,4-trichloro-3-methylbutanoyl]amino]pentanoic acid.
| Compound Name | (2S,4S)-5,5,5-trichloro-4-methyl-2-[[(3S)-4,4,4-trichloro-3-methylbutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 139114182 |
| Molecular Formula | C11H15Cl6NO3 |
| Molecular Weight | 421.96 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | (2S,4S)-5,5,5-trichloro-4-methyl-2-[[(3S)-4,4,4-trichloro-3-methylbutanoyl]amino]pentanoic acid |
| SMILES | C[C@@H](CC(=O)N[C@@H](C[C@H](C)C(Cl)(Cl)Cl)C(=O)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H15Cl6NO3/c1-5(10(12,13)14)3-7(9(20)21)18-8(19)4-6(2)11(15,16)17/h5-7H,3-4H2,1-2H3,(H,18,19)(H,20,21)/t5-,6-,7-/m0/s1 |
| InChIKey | BLZUKSBQWFWGKQ-ACZMJKKPSA-N |
| XLogP | 4.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|