C14H18O5 — CID 102412058
[(2S,3R,4S,5R)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-3-enoate (PubChem CID 102412058) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-3-enoate.
| Compound Name | [(2S,3R,4S,5R)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 102412058 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(2S,3R,4S,5R)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] but-3-enoate |
| SMILES | C=CCC(=O)O[C@H]1[C@@H](OC(C)=O)[C@@H](C=C)O[C@H]1C=C |
| InChI | InChI=1S/C14H18O5/c1-5-8-12(16)19-14-11(7-3)18-10(6-2)13(14)17-9(4)15/h5-7,10-11,13-14H,1-3,8H2,4H3/t10-,11+,13+,14-/m1/s1 |
| InChIKey | CDSZOWHDHOJXMQ-UVLXDEKHSA-N |
| XLogP | 1.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|