C30H54O7 — CID 102413097
(3Z,5S,6S,7R,8S,9S,11S,14R,15R,16S,17R,18S,19S,21E)-6,8,11,14,16,18-hexahydroxy-5,7,9,15,17,19,21-heptamethyltricosa-1,3,21-trien-12-one (PubChem CID 102413097) has the molecular formula C30H54O7 and a molecular weight of 526.76 g/mol. Its IUPAC name is (3Z,5S,6S,7R,8S,9S,11S,14R,15R,16S,17R,18S,19S,21E)-6,8,11,14,16,18-hexahydroxy-5,7,9,15,17,19,21-heptamethyltricosa-1,3,21-trien-12-one.
| Compound Name | (3Z,5S,6S,7R,8S,9S,11S,14R,15R,16S,17R,18S,19S,21E)-6,8,11,14,16,18-hexahydroxy-5,7,9,15,17,19,21-heptamethyltricosa-1,3,21-trien-12-one |
|---|---|
| PubChem CID | 102413097 |
| Molecular Formula | C30H54O7 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | (3Z,5S,6S,7R,8S,9S,11S,14R,15R,16S,17R,18S,19S,21E)-6,8,11,14,16,18-hexahydroxy-5,7,9,15,17,19,21-heptamethyltricosa-1,3,21-trien-12-one |
| SMILES | C=C/C=C\[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@H](O)C(=O)C[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)C/C(C)=C/C |
| InChI | InChI=1S/C30H54O7/c1-10-12-13-18(4)27(34)22(8)29(36)20(6)15-25(32)26(33)16-24(31)21(7)30(37)23(9)28(35)19(5)14-17(3)11-2/h10-13,18-25,27-32,34-37H,1,14-16H2,2-9H3/b13-12-,17-11+/t18-,19-,20-,21+,22-,23+,24+,25-,27-,28-,29-,30-/m0/s1 |
| InChIKey | HXYHRZIVBMFYME-BXEVLLPUSA-N |
| XLogP | 3.42 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|