C33H24F3I3O6 — CID 102414282
[3,5-bis[(2-fluoro-6-iodobenzoyl)oxymethyl]-2,4,6-trimethylphenyl]methyl 2-fluoro-6-iodobenzoate (PubChem CID 102414282) has the molecular formula C33H24F3I3O6 and a molecular weight of 954.25 g/mol. Its IUPAC name is [3,5-bis[(2-fluoro-6-iodobenzoyl)oxymethyl]-2,4,6-trimethylphenyl]methyl 2-fluoro-6-iodobenzoate.
| Compound Name | [3,5-bis[(2-fluoro-6-iodobenzoyl)oxymethyl]-2,4,6-trimethylphenyl]methyl 2-fluoro-6-iodobenzoate |
|---|---|
| PubChem CID | 102414282 |
| Molecular Formula | C33H24F3I3O6 |
| Molecular Weight | 954.25 g/mol |
| Exact Mass | 953.87 |
| IUPAC Name | [3,5-bis[(2-fluoro-6-iodobenzoyl)oxymethyl]-2,4,6-trimethylphenyl]methyl 2-fluoro-6-iodobenzoate |
| SMILES | Cc1c(COC(=O)c2c(F)cccc2I)c(C)c(COC(=O)c2c(F)cccc2I)c(C)c1COC(=O)c1c(F)cccc1I |
| InChI | InChI=1S/C33H24F3I3O6/c1-16-19(13-43-31(40)28-22(34)7-4-10-25(28)37)17(2)21(15-45-33(42)30-24(36)9-6-12-27(30)39)18(3)20(16)14-44-32(41)29-23(35)8-5-11-26(29)38/h4-12H,13-15H2,1-3H3 |
| InChIKey | HUULGTQZJXJSNG-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.25 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|