C22H22F3NO3 — CID 102415912
methyl 2-[(3R,7aS)-1,1-diphenyl-3-(trifluoromethyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-yl]acetate (PubChem CID 102415912) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is methyl 2-[(3R,7aS)-1,1-diphenyl-3-(trifluoromethyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-yl]acetate.
| Compound Name | methyl 2-[(3R,7aS)-1,1-diphenyl-3-(trifluoromethyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-yl]acetate |
|---|---|
| PubChem CID | 102415912 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 2-[(3R,7aS)-1,1-diphenyl-3-(trifluoromethyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-3-yl]acetate |
| SMILES | COC(=O)C[C@]1(C(F)(F)F)OC(c2ccccc2)(c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C22H22F3NO3/c1-28-19(27)15-20(22(23,24)25)26-14-8-13-18(26)21(29-20,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18H,8,13-15H2,1H3/t18-,20+/m0/s1 |
| InChIKey | OUTNIKIQIFYLMP-AZUAARDMSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |