C27H35ClN4O3 — CID 102416228
butyl 4-[[2-chloro-4-(4-hexanoylpiperazin-1-yl)phenyl]diazenyl]benzoate (PubChem CID 102416228) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is butyl 4-[[2-chloro-4-(4-hexanoylpiperazin-1-yl)phenyl]diazenyl]benzoate.
| Compound Name | butyl 4-[[2-chloro-4-(4-hexanoylpiperazin-1-yl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 102416228 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | butyl 4-[[2-chloro-4-(4-hexanoylpiperazin-1-yl)phenyl]diazenyl]benzoate |
| SMILES | CCCCCC(=O)N1CCN(c2ccc(/N=N/c3ccc(C(=O)OCCCC)cc3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C27H35ClN4O3/c1-3-5-7-8-26(33)32-17-15-31(16-18-32)23-13-14-25(24(28)20-23)30-29-22-11-9-21(10-12-22)27(34)35-19-6-4-2/h9-14,20H,3-8,15-19H2,1-2H3/b30-29+ |
| InChIKey | YJIWWRKFIMUHHM-QVIHXGFCSA-N |
| XLogP | 6.94 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|