C12H16N4O2 — CID 102416597
(2R,3R)-2-N,3-N-dimethyl-1-(pyridin-2-ylmethyl)aziridine-2,3-dicarboxamide (PubChem CID 102416597) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is (2R,3R)-2-N,3-N-dimethyl-1-(pyridin-2-ylmethyl)aziridine-2,3-dicarboxamide.
| Compound Name | (2R,3R)-2-N,3-N-dimethyl-1-(pyridin-2-ylmethyl)aziridine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 102416597 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (2R,3R)-2-N,3-N-dimethyl-1-(pyridin-2-ylmethyl)aziridine-2,3-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H](C(=O)NC)N1Cc1ccccn1 |
| InChI | InChI=1S/C12H16N4O2/c1-13-11(17)9-10(12(18)14-2)16(9)7-8-5-3-4-6-15-8/h3-6,9-10H,7H2,1-2H3,(H,13,17)(H,14,18)/t9-,10-/m1/s1 |
| InChIKey | ABLDXPGMTIMSFO-NXEZZACHSA-N |
| XLogP | -0.87 |
| TPSA | 74.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|