C26H24N4O5 — CID 102417626
ethyl 2-[[7-(4-methoxyphenyl)-8-oxo-4,7,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11,13,15-hexaene-6-carbonyl]amino]acetate (PubChem CID 102417626) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is ethyl 2-[[7-(4-methoxyphenyl)-8-oxo-4,7,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11,13,15-hexaene-6-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[7-(4-methoxyphenyl)-8-oxo-4,7,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11,13,15-hexaene-6-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 102417626 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | ethyl 2-[[7-(4-methoxyphenyl)-8-oxo-4,7,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4,11,13,15-hexaene-6-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1c2nccc3c4ccccc4n(c23)CC(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H24N4O5/c1-3-35-22(32)14-28-26(33)25-23-24-19(12-13-27-23)18-6-4-5-7-20(18)29(24)15-21(31)30(25)16-8-10-17(34-2)11-9-16/h4-13,25H,3,14-15H2,1-2H3,(H,28,33) |
| InChIKey | UIVXBBOCFDWQEP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |