C31H34O15 — CID 102417831
[(2R,3S,4S,5R,6S)-6-[[2-(benzoyloxymethyl)-6-methoxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 102417831) has the molecular formula C31H34O15 and a molecular weight of 646.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[2-(benzoyloxymethyl)-6-methoxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[2-(benzoyloxymethyl)-6-methoxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 102417831 |
| Molecular Formula | C31H34O15 |
| Molecular Weight | 646.60 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[2-(benzoyloxymethyl)-6-methoxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | COC12CC3(C)OC(O1)C1(COC(=O)c4ccccc4)C2CC31O[C@@H]1O[C@H](COC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C31H34O15/c1-28-12-30(40-2)19-10-31(28,29(19,27(45-28)46-30)13-42-24(38)14-6-4-3-5-7-14)44-26-23(37)22(36)21(35)18(43-26)11-41-25(39)15-8-16(32)20(34)17(33)9-15/h3-9,18-19,21-23,26-27,32-37H,10-13H2,1-2H3/t18-,19?,21-,22+,23-,26+,27?,28?,29?,30?,31?/m1/s1 |
| InChIKey | VQNYYCZTWCMUQV-GNJVKIKPSA-N |
| XLogP | 0.28 |
| TPSA | 220.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.60 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|