C23H28O14 — CID 154790759
[3,4,5-trihydroxy-6-[[(1R,3R,6R,8S)-6-hydroxy-2-(hydroxymethyl)-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 154790759) has the molecular formula C23H28O14 and a molecular weight of 528.46 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-[[(1R,3R,6R,8S)-6-hydroxy-2-(hydroxymethyl)-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [3,4,5-trihydroxy-6-[[(1R,3R,6R,8S)-6-hydroxy-2-(hydroxymethyl)-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 154790759 |
| Molecular Formula | C23H28O14 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | [3,4,5-trihydroxy-6-[[(1R,3R,6R,8S)-6-hydroxy-2-(hydroxymethyl)-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-3-yl]oxy]oxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | C[C@@]12C[C@@]3(O)O[C@@H](O1)C1(CO)C3C[C@@]12OC1OC(COC(=O)c2cc(O)c(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C23H28O14/c1-20-6-22(32)12-4-23(20,21(12,7-24)19(36-20)37-22)35-18-16(30)15(29)14(28)11(34-18)5-33-17(31)8-2-9(25)13(27)10(26)3-8/h2-3,11-12,14-16,18-19,24-30,32H,4-7H2,1H3/t11?,12?,14?,15?,16?,18?,19-,20+,21?,22-,23+/m1/s1 |
| InChIKey | VUMDOEIOARUSRC-LOUSTULBSA-N |
| XLogP | -2.24 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|