C27H47NaO12S — CID 102418618
sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-hydroxy-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]oxan-2-yl]methyl sulfate (PubChem CID 102418618) has the molecular formula C27H47NaO12S and a molecular weight of 618.72 g/mol. Its IUPAC name is sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-hydroxy-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]oxan-2-yl]methyl sulfate.
| Compound Name | sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-hydroxy-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 102418618 |
| Molecular Formula | C27H47NaO12S |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2S)-2-hydroxy-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]oxan-2-yl]methyl sulfate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H](O)CO[C@H]1O[C@H](COS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C27H48O12S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(29)36-18-21(28)19-37-27-26(32)25(31)24(30)22(39-27)20-38-40(33,34)35;/h6-7,9-10,21-22,24-28,30-32H,2-5,8,11-20H2,1H3,(H,33,34,35);/q;+1/p-1/b7-6-,10-9-;/t21-,22-,24-,25+,26-,27+;/m1./s1 |
| InChIKey | GBYSNFKCCMLRKR-YYZFRIICSA-M |
| XLogP | -0.99 |
| TPSA | 192.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|