C16H23NO4S — CID 102420408
methyl (2S)-2-[[2-(3-cyclopenta-2,4-dien-1-yl-3-oxopropyl)sulfanylacetyl]amino]-3-methylbutanoate (PubChem CID 102420408) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(3-cyclopenta-2,4-dien-1-yl-3-oxopropyl)sulfanylacetyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-(3-cyclopenta-2,4-dien-1-yl-3-oxopropyl)sulfanylacetyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 102420408 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl (2S)-2-[[2-(3-cyclopenta-2,4-dien-1-yl-3-oxopropyl)sulfanylacetyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CSCCC(=O)C1C=CC=C1)C(C)C |
| InChI | InChI=1S/C16H23NO4S/c1-11(2)15(16(20)21-3)17-14(19)10-22-9-8-13(18)12-6-4-5-7-12/h4-7,11-12,15H,8-10H2,1-3H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | CVGVCMNTZCWBNK-HNNXBMFYSA-N |
| XLogP | 1.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|