C21H20N6O — CID 102421880
4-phenylmethoxy-2,7-bis(prop-2-enylamino)pyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 102421880) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-phenylmethoxy-2,7-bis(prop-2-enylamino)pyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 4-phenylmethoxy-2,7-bis(prop-2-enylamino)pyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 102421880 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-phenylmethoxy-2,7-bis(prop-2-enylamino)pyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | C=CCNc1nc(OCc2ccccc2)c2cc(C#N)c(NCC=C)nc2n1 |
| InChI | InChI=1S/C21H20N6O/c1-3-10-23-18-16(13-22)12-17-19(25-18)26-21(24-11-4-2)27-20(17)28-14-15-8-6-5-7-9-15/h3-9,12H,1-2,10-11,14H2,(H2,23,24,25,26,27) |
| InChIKey | QDVKTKOLUINWQW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|