C18H16O2 — CID 102421896
2,2-dimethyl-4,5-diphenylfuran-3-one (PubChem CID 102421896) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,2-dimethyl-4,5-diphenylfuran-3-one.
| Compound Name | 2,2-dimethyl-4,5-diphenylfuran-3-one |
|---|---|
| PubChem CID | 102421896 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2,2-dimethyl-4,5-diphenylfuran-3-one |
| SMILES | CC1(C)OC(c2ccccc2)=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16O2/c1-18(2)17(19)15(13-9-5-3-6-10-13)16(20-18)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | IYVQBSDYUYLTER-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|