C10H10O5 — CID 10242206
(7S)-7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione (PubChem CID 10242206) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is (7S)-7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione.
| Compound Name | (7S)-7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione |
|---|---|
| PubChem CID | 10242206 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (7S)-7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione |
| SMILES | CC[C@@H]1OC(=O)c2c(OC)cc(=O)oc21 |
| InChI | InChI=1S/C10H10O5/c1-3-5-9-8(10(12)14-5)6(13-2)4-7(11)15-9/h4-5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | LAVJUISMIZTLGI-YFKPBYRVSA-N |
| XLogP | 1.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |