C12H18O3 — CID 10242225
4,4-dimethoxy-2-methyl-3-(3-methylbut-3-enyl)cyclobut-2-en-1-one (PubChem CID 10242225) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4,4-dimethoxy-2-methyl-3-(3-methylbut-3-enyl)cyclobut-2-en-1-one.
| Compound Name | 4,4-dimethoxy-2-methyl-3-(3-methylbut-3-enyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10242225 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4,4-dimethoxy-2-methyl-3-(3-methylbut-3-enyl)cyclobut-2-en-1-one |
| SMILES | C=C(C)CCC1=C(C)C(=O)C1(OC)OC |
| InChI | InChI=1S/C12H18O3/c1-8(2)6-7-10-9(3)11(13)12(10,14-4)15-5/h1,6-7H2,2-5H3 |
| InChIKey | CMGOJEZLUBBIDV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|