C12H18O3 — CID 10420682
3-[(E)-1-deuteriopent-3-enyl]-4,4-dimethoxy-2-methylcyclobut-2-en-1-one (PubChem CID 10420682) has the molecular formula C12H18O3 and a molecular weight of 211.28 g/mol. Its IUPAC name is 3-[(E)-1-deuteriopent-3-enyl]-4,4-dimethoxy-2-methylcyclobut-2-en-1-one.
| Compound Name | 3-[(E)-1-deuteriopent-3-enyl]-4,4-dimethoxy-2-methylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10420682 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[(E)-1-deuteriopent-3-enyl]-4,4-dimethoxy-2-methylcyclobut-2-en-1-one |
| SMILES | [2H]C(C/C=C/C)C1=C(C)C(=O)C1(OC)OC |
| InChI | InChI=1S/C12H18O3/c1-5-6-7-8-10-9(2)11(13)12(10,14-3)15-4/h5-6H,7-8H2,1-4H3/b6-5+/i8D |
| InChIKey | ANPODQXVMDCHAS-VBIDLDGSSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|