C10H12O3 — CID 10442293
2,3-bis(ethenyl)-4,4-dimethoxycyclobut-2-en-1-one (PubChem CID 10442293) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4,4-dimethoxycyclobut-2-en-1-one.
| Compound Name | 2,3-bis(ethenyl)-4,4-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10442293 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2,3-bis(ethenyl)-4,4-dimethoxycyclobut-2-en-1-one |
| SMILES | C=CC1=C(C=C)C(OC)(OC)C1=O |
| InChI | InChI=1S/C10H12O3/c1-5-7-8(6-2)10(12-3,13-4)9(7)11/h5-6H,1-2H2,3-4H3 |
| InChIKey | KUGVWKPRAAMKSE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|