C20H26O3 — CID 138643983
(2Z,4E,8E,9Z)-7,7-dimethoxy-5-[(Z)-prop-1-enyl]-8-prop-2-enylidenedodeca-2,4,9,11-tetraen-6-one (PubChem CID 138643983) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2Z,4E,8E,9Z)-7,7-dimethoxy-5-[(Z)-prop-1-enyl]-8-prop-2-enylidenedodeca-2,4,9,11-tetraen-6-one.
| Compound Name | (2Z,4E,8E,9Z)-7,7-dimethoxy-5-[(Z)-prop-1-enyl]-8-prop-2-enylidenedodeca-2,4,9,11-tetraen-6-one |
|---|---|
| PubChem CID | 138643983 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2Z,4E,8E,9Z)-7,7-dimethoxy-5-[(Z)-prop-1-enyl]-8-prop-2-enylidenedodeca-2,4,9,11-tetraen-6-one |
| SMILES | C=C/C=C\C(=C/C=C)C(OC)(OC)C(=O)C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C20H26O3/c1-7-11-15-17(13-9-3)19(21)20(22-5,23-6)18(14-10-4)16-12-8-2/h7-16H,2,4H2,1,3,5-6H3/b11-7-,13-9-,16-12-,17-15+,18-14+ |
| InChIKey | WFNYIDVZTWARGU-MIHQQVGISA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|