C14H18O3 — CID 123563592
(2E,7E)-3,8-dimethoxy-5,6-dimethylidenedeca-2,7,9-trien-4-one (PubChem CID 123563592) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2E,7E)-3,8-dimethoxy-5,6-dimethylidenedeca-2,7,9-trien-4-one.
| Compound Name | (2E,7E)-3,8-dimethoxy-5,6-dimethylidenedeca-2,7,9-trien-4-one |
|---|---|
| PubChem CID | 123563592 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2E,7E)-3,8-dimethoxy-5,6-dimethylidenedeca-2,7,9-trien-4-one |
| SMILES | C=C/C(=C\C(=C)C(=C)C(=O)/C(=C\C)OC)OC |
| InChI | InChI=1S/C14H18O3/c1-7-12(16-5)9-10(3)11(4)14(15)13(8-2)17-6/h7-9H,1,3-4H2,2,5-6H3/b12-9+,13-8+ |
| InChIKey | HLRRHLFUJUBGRQ-GHEQENTPSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|