C20H26O4 — CID 5320195
5-[(2E,6Z,7Z)-6-ethylidene-2-methylnona-2,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 5320195) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 5-[(2E,6Z,7Z)-6-ethylidene-2-methylnona-2,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[(2E,6Z,7Z)-6-ethylidene-2-methylnona-2,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5320195 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-[(2E,6Z,7Z)-6-ethylidene-2-methylnona-2,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | C/C=C\C(=C/C)CC/C=C(\C)CC1=CC(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C20H26O4/c1-6-9-15(7-2)11-8-10-14(3)12-16-13-17(21)19(23-4)20(24-5)18(16)22/h6-7,9-10,13H,8,11-12H2,1-5H3/b9-6-,14-10+,15-7+ |
| InChIKey | ANADSPNYXLLDHF-BNNQPLILSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|