C13H21NO9S — CID 102423159
methyl (2S,3R,4S)-2-[(4S,5R)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-4-hydroxy-5-oxopyrrolidine-3-carboxylate (PubChem CID 102423159) has the molecular formula C13H21NO9S and a molecular weight of 367.38 g/mol. Its IUPAC name is methyl (2S,3R,4S)-2-[(4S,5R)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-4-hydroxy-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3R,4S)-2-[(4S,5R)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-4-hydroxy-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 102423159 |
| Molecular Formula | C13H21NO9S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | methyl (2S,3R,4S)-2-[(4S,5R)-2,2-dimethyl-5-(methylsulfonyloxymethyl)-1,3-dioxolan-4-yl]-4-hydroxy-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@@H]2OC(C)(C)O[C@@H]2COS(C)(=O)=O)NC(=O)[C@H]1O |
| InChI | InChI=1S/C13H21NO9S/c1-13(2)22-6(5-21-24(4,18)19)10(23-13)8-7(12(17)20-3)9(15)11(16)14-8/h6-10,15H,5H2,1-4H3,(H,14,16)/t6-,7-,8+,9+,10-/m1/s1 |
| InChIKey | IMIQMRUHALTYFL-FHNUBNKASA-N |
| XLogP | -1.87 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|