C12H19NO7 — CID 102423162
methyl (2S,3R,4S)-4-hydroxy-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 102423162) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is methyl (2S,3R,4S)-4-hydroxy-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3R,4S)-4-hydroxy-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 102423162 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | methyl (2S,3R,4S)-4-hydroxy-2-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@@H]2OC(C)(C)O[C@@H]2CO)NC(=O)[C@H]1O |
| InChI | InChI=1S/C12H19NO7/c1-12(2)19-5(4-14)9(20-12)7-6(11(17)18-3)8(15)10(16)13-7/h5-9,14-15H,4H2,1-3H3,(H,13,16)/t5-,6-,7+,8+,9-/m1/s1 |
| InChIKey | JKNGIXDQEFNYFN-XGQMLPDNSA-N |
| XLogP | -1.85 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |