C9H13NO7 — CID 162928960
(2S,4R)-5-oxo-4-[(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]pyrrolidine-2-carboxylic acid (PubChem CID 162928960) has the molecular formula C9H13NO7 and a molecular weight of 247.20 g/mol. Its IUPAC name is (2S,4R)-5-oxo-4-[(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-5-oxo-4-[(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 162928960 |
| Molecular Formula | C9H13NO7 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2S,4R)-5-oxo-4-[(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]([C@@]2(O)OC[C@@H](O)[C@@H]2O)C(=O)N1 |
| InChI | InChI=1S/C9H13NO7/c11-5-2-17-9(16,6(5)12)3-1-4(8(14)15)10-7(3)13/h3-6,11-12,16H,1-2H2,(H,10,13)(H,14,15)/t3-,4-,5+,6-,9+/m0/s1 |
| InChIKey | ZFMUVQSKECLHAK-HYMLEYLXSA-N |
| XLogP | -2.98 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |