C11H11NO8 — CID 118728994
(1S,2S,6S,8R,9R)-8-(carboxymethyl)-4,11-dioxo-3,7-dioxa-10-azatricyclo[6.3.0.02,6]undecane-9-carboxylic acid (PubChem CID 118728994) has the molecular formula C11H11NO8 and a molecular weight of 285.21 g/mol. Its IUPAC name is (1S,2S,6S,8R,9R)-8-(carboxymethyl)-4,11-dioxo-3,7-dioxa-10-azatricyclo[6.3.0.02,6]undecane-9-carboxylic acid.
| Compound Name | (1S,2S,6S,8R,9R)-8-(carboxymethyl)-4,11-dioxo-3,7-dioxa-10-azatricyclo[6.3.0.02,6]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 118728994 |
| Molecular Formula | C11H11NO8 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (1S,2S,6S,8R,9R)-8-(carboxymethyl)-4,11-dioxo-3,7-dioxa-10-azatricyclo[6.3.0.02,6]undecane-9-carboxylic acid |
| SMILES | O=C(O)C[C@@]12O[C@H]3CC(=O)O[C@H]3[C@@H]1C(=O)N[C@H]2C(=O)O |
| InChI | InChI=1S/C11H11NO8/c13-4(14)2-11-6(9(16)12-8(11)10(17)18)7-3(20-11)1-5(15)19-7/h3,6-8H,1-2H2,(H,12,16)(H,13,14)(H,17,18)/t3-,6+,7+,8-,11+/m0/s1 |
| InChIKey | HALMTFOIXNHUCD-CCROJDGWSA-N |
| XLogP | -1.89 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |