C14H15NO — CID 102424510
(2Z,5R,6E)-5-hydroxy-5-methyl-7-phenylhepta-2,6-dienenitrile (PubChem CID 102424510) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (2Z,5R,6E)-5-hydroxy-5-methyl-7-phenylhepta-2,6-dienenitrile.
| Compound Name | (2Z,5R,6E)-5-hydroxy-5-methyl-7-phenylhepta-2,6-dienenitrile |
|---|---|
| PubChem CID | 102424510 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2Z,5R,6E)-5-hydroxy-5-methyl-7-phenylhepta-2,6-dienenitrile |
| SMILES | C[C@](O)(/C=C/c1ccccc1)C/C=C\C#N |
| InChI | InChI=1S/C14H15NO/c1-14(16,10-5-6-12-15)11-9-13-7-3-2-4-8-13/h2-9,11,16H,10H2,1H3/b6-5-,11-9+/t14-/m1/s1 |
| InChIKey | CISCZXCRWZOGNL-NJTRKQSOSA-N |
| XLogP | 2.92 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|