C21H36N2S — CID 102430047
1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea (PubChem CID 102430047) has the molecular formula C21H36N2S and a molecular weight of 348.60 g/mol. Its IUPAC name is 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea.
| Compound Name | 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea |
|---|---|
| PubChem CID | 102430047 |
| Molecular Formula | C21H36N2S |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1,3-bis[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=S)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H36N2S/c1-17(2)9-7-11-19(5)13-15-22-21(24)23-16-14-20(6)12-8-10-18(3)4/h9-10,13-14H,7-8,11-12,15-16H2,1-6H3,(H2,22,23,24)/b19-13+,20-14+ |
| InChIKey | GCEXTBLRBGAHKF-IWGRKNQJSA-N |
| XLogP | 5.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|