C9H18N2S — CID 165175586
6-methylhept-2-enylthiourea (PubChem CID 165175586) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 6-methylhept-2-enylthiourea.
| Compound Name | 6-methylhept-2-enylthiourea |
|---|---|
| PubChem CID | 165175586 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 6-methylhept-2-enylthiourea |
| SMILES | CC(C)CCC=CCNC(N)=S |
| InChI | InChI=1S/C9H18N2S/c1-8(2)6-4-3-5-7-11-9(10)12/h3,5,8H,4,6-7H2,1-2H3,(H3,10,11,12) |
| InChIKey | MVILPEPPKJYHQO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|