About tridec-2-enylthiourea
tridec-2-enylthiourea (PubChem CID 165175584) has the molecular formula C14H28N2S
and a molecular weight of 256.46 g/mol. Its IUPAC name is tridec-2-enylthiourea.
Molecular Properties
| Compound Name | tridec-2-enylthiourea |
| PubChem CID | 165175584 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | tridec-2-enylthiourea |
| SMILES | CCCCCCCCCCC=CCNC(N)=S |
| InChI | InChI=1S/C14H28N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14(15)17/h11-12H,2-10,13H2,1H3,(H3,15,16,17) |
| InChIKey | XQGXQSGQCQHGMA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tridec-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridec-2-enylthiourea?
The IUPAC name of tridec-2-enylthiourea (CID 165175584) is tridec-2-enylthiourea.
What is the SMILES notation for tridec-2-enylthiourea?
The canonical SMILES for tridec-2-enylthiourea is CCCCCCCCCCC=CCNC(N)=S.
What is the InChIKey of tridec-2-enylthiourea?
The InChIKey is XQGXQSGQCQHGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14(15)17/h11-12H,2-10,13H2,1H3,(H3,15,16,17).
What are the key properties of tridec-2-enylthiourea?
tridec-2-enylthiourea has a molecular weight of 256.46 g/mol, XLogP of 3.91, 11 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridec-2-enylthiourea is sourced from PubChem (CID 165175584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).