C15H20N2S — CID 143969045
[(Z)-4-(5-propan-2-ylcyclohepta-1,2,4,6-tetraen-1-yl)but-3-enyl]thiourea (PubChem CID 143969045) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is [(Z)-4-(5-propan-2-ylcyclohepta-1,2,4,6-tetraen-1-yl)but-3-enyl]thiourea.
| Compound Name | [(Z)-4-(5-propan-2-ylcyclohepta-1,2,4,6-tetraen-1-yl)but-3-enyl]thiourea |
|---|---|
| PubChem CID | 143969045 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(Z)-4-(5-propan-2-ylcyclohepta-1,2,4,6-tetraen-1-yl)but-3-enyl]thiourea |
| SMILES | CC(C)C1=CC=C=C(/C=C\CCNC(N)=S)C=C1 |
| InChI | InChI=1S/C15H20N2S/c1-12(2)14-8-5-7-13(9-10-14)6-3-4-11-17-15(16)18/h3,5-6,8-10,12H,4,11H2,1-2H3,(H3,16,17,18)/b6-3- |
| InChIKey | GHSDFRYYNJYEEN-UTCJRWHESA-N |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|