C13H16N2S — CID 101487294
1,3-bis(cyclopenta-2,4-dien-1-ylmethyl)thiourea (PubChem CID 101487294) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 1,3-bis(cyclopenta-2,4-dien-1-ylmethyl)thiourea.
| Compound Name | 1,3-bis(cyclopenta-2,4-dien-1-ylmethyl)thiourea |
|---|---|
| PubChem CID | 101487294 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1,3-bis(cyclopenta-2,4-dien-1-ylmethyl)thiourea |
| SMILES | S=C(NCC1C=CC=C1)NCC1C=CC=C1 |
| InChI | InChI=1S/C13H16N2S/c16-13(14-9-11-5-1-2-6-11)15-10-12-7-3-4-8-12/h1-8,11-12H,9-10H2,(H2,14,15,16) |
| InChIKey | FQPADUUFZRGCTC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|