C10H16N2S — CID 59960034
1-methyl-3-[(3E,5Z)-octa-3,5,7-trienyl]thiourea (PubChem CID 59960034) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-methyl-3-[(3E,5Z)-octa-3,5,7-trienyl]thiourea.
| Compound Name | 1-methyl-3-[(3E,5Z)-octa-3,5,7-trienyl]thiourea |
|---|---|
| PubChem CID | 59960034 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-methyl-3-[(3E,5Z)-octa-3,5,7-trienyl]thiourea |
| SMILES | C=C/C=C\C=C\CCNC(=S)NC |
| InChI | InChI=1S/C10H16N2S/c1-3-4-5-6-7-8-9-12-10(13)11-2/h3-7H,1,8-9H2,2H3,(H2,11,12,13)/b5-4-,7-6+ |
| InChIKey | BASSRDQNPPNKSL-SCFJQAPRSA-N |
| XLogP | 1.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|