C9H21N3 — CID 123541630
1-N'-[(hex-3-enylamino)methyl]ethane-1,1-diamine (PubChem CID 123541630) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 1-N'-[(hex-3-enylamino)methyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[(hex-3-enylamino)methyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 123541630 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1-N'-[(hex-3-enylamino)methyl]ethane-1,1-diamine |
| SMILES | CCC=CCCNCNC(C)N |
| InChI | InChI=1S/C9H21N3/c1-3-4-5-6-7-11-8-12-9(2)10/h4-5,9,11-12H,3,6-8,10H2,1-2H3 |
| InChIKey | LFKWNEKCUNMAJP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|