C13H22N2S — CID 142317447
1-tert-butyl-3-[(3Z)-3-ethenylhexa-3,5-dienyl]thiourea (PubChem CID 142317447) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-tert-butyl-3-[(3Z)-3-ethenylhexa-3,5-dienyl]thiourea.
| Compound Name | 1-tert-butyl-3-[(3Z)-3-ethenylhexa-3,5-dienyl]thiourea |
|---|---|
| PubChem CID | 142317447 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-tert-butyl-3-[(3Z)-3-ethenylhexa-3,5-dienyl]thiourea |
| SMILES | C=C/C=C(\C=C)CCNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C13H22N2S/c1-6-8-11(7-2)9-10-14-12(16)15-13(3,4)5/h6-8H,1-2,9-10H2,3-5H3,(H2,14,15,16)/b11-8+ |
| InChIKey | AMGNZPHRYYIPHY-DHZHZOJOSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|