C10H16N2S — CID 142873058
1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-methylthiourea (PubChem CID 142873058) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-methylthiourea.
| Compound Name | 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-methylthiourea |
|---|---|
| PubChem CID | 142873058 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-[(3Z)-3-ethenylhexa-3,5-dienyl]-3-methylthiourea |
| SMILES | C=C/C=C(\C=C)CCNC(=S)NC |
| InChI | InChI=1S/C10H16N2S/c1-4-6-9(5-2)7-8-12-10(13)11-3/h4-6H,1-2,7-8H2,3H3,(H2,11,12,13)/b9-6+ |
| InChIKey | AQPFCRDKSPRCTC-RMKNXTFCSA-N |
| XLogP | 1.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|