C15H16N2S — CID 134159645
1,3-di(cyclohepta-2,4,6-trien-1-yl)thiourea (PubChem CID 134159645) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1,3-di(cyclohepta-2,4,6-trien-1-yl)thiourea.
| Compound Name | 1,3-di(cyclohepta-2,4,6-trien-1-yl)thiourea |
|---|---|
| PubChem CID | 134159645 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1,3-di(cyclohepta-2,4,6-trien-1-yl)thiourea |
| SMILES | S=C(NC1C=CC=CC=C1)NC1C=CC=CC=C1 |
| InChI | InChI=1S/C15H16N2S/c18-15(16-13-9-5-1-2-6-10-13)17-14-11-7-3-4-8-12-14/h1-14H,(H2,16,17,18) |
| InChIKey | XIPQGDSAZNDUDB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|