C15H23FN2S — CID 90923956
3-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-2-methylbutyl]-1,1-dimethylthiourea (PubChem CID 90923956) has the molecular formula C15H23FN2S and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-2-methylbutyl]-1,1-dimethylthiourea.
| Compound Name | 3-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-2-methylbutyl]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 90923956 |
| Molecular Formula | C15H23FN2S |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)-2-methylbutyl]-1,1-dimethylthiourea |
| SMILES | CC(CCC1=CCC=C(F)C=C1)CNC(=S)N(C)C |
| InChI | InChI=1S/C15H23FN2S/c1-12(11-17-15(19)18(2)3)7-8-13-5-4-6-14(16)10-9-13/h5-6,9-10,12H,4,7-8,11H2,1-3H3,(H,17,19) |
| InChIKey | LJPMIIPUZXFDGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|