C21H22N2 — CID 102430453
(3R,3'R)-1'-benzyl-3'-ethenylspiro[indole-3,4'-piperidine] (PubChem CID 102430453) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3R,3'R)-1'-benzyl-3'-ethenylspiro[indole-3,4'-piperidine].
| Compound Name | (3R,3'R)-1'-benzyl-3'-ethenylspiro[indole-3,4'-piperidine] |
|---|---|
| PubChem CID | 102430453 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (3R,3'R)-1'-benzyl-3'-ethenylspiro[indole-3,4'-piperidine] |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)CC[C@@]12C=Nc1ccccc12 |
| InChI | InChI=1S/C21H22N2/c1-2-18-15-23(14-17-8-4-3-5-9-17)13-12-21(18)16-22-20-11-7-6-10-19(20)21/h2-11,16,18H,1,12-15H2/t18-,21+/m0/s1 |
| InChIKey | GUJBHEIKXYLMAW-GHTZIAJQSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|