C17H10N2O3 — CID 102432124
methyl 10-oxo-8,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaene-15-carboxylate (PubChem CID 102432124) has the molecular formula C17H10N2O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 10-oxo-8,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaene-15-carboxylate.
| Compound Name | methyl 10-oxo-8,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaene-15-carboxylate |
|---|---|
| PubChem CID | 102432124 |
| Molecular Formula | C17H10N2O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | methyl 10-oxo-8,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,11,13,15-octaene-15-carboxylate |
| SMILES | COC(=O)c1cc2c3c(nc4ccccc4c3n1)C(=O)C=C2 |
| InChI | InChI=1S/C17H10N2O3/c1-22-17(21)12-8-9-6-7-13(20)16-14(9)15(19-12)10-4-2-3-5-11(10)18-16/h2-8H,1H3 |
| InChIKey | XCXUOPBJJPREON-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|