C18H14N2O2 — CID 136695301
methyl 6-methyl-4H-pyrido[3,2-a]carbazole-2-carboxylate (PubChem CID 136695301) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 6-methyl-4H-pyrido[3,2-a]carbazole-2-carboxylate.
| Compound Name | methyl 6-methyl-4H-pyrido[3,2-a]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 136695301 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 6-methyl-4H-pyrido[3,2-a]carbazole-2-carboxylate |
| SMILES | COC(=O)c1c[nH]c2cc(C)c3c4ccccc4nc3c2c1 |
| InChI | InChI=1S/C18H14N2O2/c1-10-7-15-13(8-11(9-19-15)18(21)22-2)17-16(10)12-5-3-4-6-14(12)20-17/h3-9,19H,1-2H3 |
| InChIKey | SNFNVVLNSBXTFV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |