C23H29NO7 — CID 102432516
triethyl 1-(4-methoxyphenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate (PubChem CID 102432516) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is triethyl 1-(4-methoxyphenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate.
| Compound Name | triethyl 1-(4-methoxyphenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 102432516 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | triethyl 1-(4-methoxyphenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(OC)cc2)C(C)=C(C(=O)OCC)C1C(=O)OCC |
| InChI | InChI=1S/C23H29NO7/c1-7-29-21(25)18-14(4)24(16-10-12-17(28-6)13-11-16)15(5)19(22(26)30-8-2)20(18)23(27)31-9-3/h10-13,20H,7-9H2,1-6H3 |
| InChIKey | LBMVSAOTGWASQB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|